C28H59N5O4 — CID 90367837
2-[[4,8-bis(tert-butylamino)-3-oxooctan-2-yl]amino]-N-[2-(2-methoxyethoxy)ethyl]-6-(methylamino)hexanamide (PubChem CID 90367837) has the molecular formula C28H59N5O4 and a molecular weight of 529.81 g/mol. Its IUPAC name is 2-[[4,8-bis(tert-butylamino)-3-oxooctan-2-yl]amino]-N-[2-(2-methoxyethoxy)ethyl]-6-(methylamino)hexanamide.
| Compound Name | 2-[[4,8-bis(tert-butylamino)-3-oxooctan-2-yl]amino]-N-[2-(2-methoxyethoxy)ethyl]-6-(methylamino)hexanamide |
|---|---|
| PubChem CID | 90367837 |
| Molecular Formula | C28H59N5O4 |
| Molecular Weight | 529.81 g/mol |
| Exact Mass | 529.46 |
| IUPAC Name | 2-[[4,8-bis(tert-butylamino)-3-oxooctan-2-yl]amino]-N-[2-(2-methoxyethoxy)ethyl]-6-(methylamino)hexanamide |
| SMILES | CNCCCCC(NC(C)C(=O)C(CCCCNC(C)(C)C)NC(C)(C)C)C(=O)NCCOCCOC |
| InChI | InChI=1S/C28H59N5O4/c1-22(25(34)23(33-28(5,6)7)14-11-13-17-31-27(2,3)4)32-24(15-10-12-16-29-8)26(35)30-18-19-37-21-20-36-9/h22-24,29,31-33H,10-21H2,1-9H3,(H,30,35) |
| InChIKey | DPBPKJDVDKLCSX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 112.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.81 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|