C15H29NO2 — CID 167639018
N-(2,4-dimethylpentan-3-yl)-5,5-dimethyl-4-oxohexanamide (PubChem CID 167639018) has the molecular formula C15H29NO2 and a molecular weight of 255.40 g/mol. Its IUPAC name is N-(2,4-dimethylpentan-3-yl)-5,5-dimethyl-4-oxohexanamide.
| Compound Name | N-(2,4-dimethylpentan-3-yl)-5,5-dimethyl-4-oxohexanamide |
|---|---|
| PubChem CID | 167639018 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | N-(2,4-dimethylpentan-3-yl)-5,5-dimethyl-4-oxohexanamide |
| SMILES | CC(C)C(NC(=O)CCC(=O)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C15H29NO2/c1-10(2)14(11(3)4)16-13(18)9-8-12(17)15(5,6)7/h10-11,14H,8-9H2,1-7H3,(H,16,18) |
| InChIKey | GEXAPFPLLSGFIH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |