C22H39NO7 — CID 178008588
N-[1-(4-methyl-3-oxopentoxy)-2-(3-oxobutoxymethyl)-3-(3-oxopentoxy)propan-2-yl]propanamide (PubChem CID 178008588) has the molecular formula C22H39NO7 and a molecular weight of 429.55 g/mol. Its IUPAC name is N-[1-(4-methyl-3-oxopentoxy)-2-(3-oxobutoxymethyl)-3-(3-oxopentoxy)propan-2-yl]propanamide.
| Compound Name | N-[1-(4-methyl-3-oxopentoxy)-2-(3-oxobutoxymethyl)-3-(3-oxopentoxy)propan-2-yl]propanamide |
|---|---|
| PubChem CID | 178008588 |
| Molecular Formula | C22H39NO7 |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | N-[1-(4-methyl-3-oxopentoxy)-2-(3-oxobutoxymethyl)-3-(3-oxopentoxy)propan-2-yl]propanamide |
| SMILES | CCC(=O)CCOCC(COCCC(C)=O)(COCCC(=O)C(C)C)NC(=O)CC |
| InChI | InChI=1S/C22H39NO7/c1-6-19(25)9-12-29-15-22(23-21(27)7-2,14-28-11-8-18(5)24)16-30-13-10-20(26)17(3)4/h17H,6-16H2,1-5H3,(H,23,27) |
| InChIKey | TTXZKXCTKGMOOV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|