C19H33NO10 — CID 134401167
methyl 3-[3-(3-methoxy-3-oxopropoxy)-2-[(3-methoxy-3-oxopropoxy)methyl]-2-(propanoylamino)propoxy]propanoate (PubChem CID 134401167) has the molecular formula C19H33NO10 and a molecular weight of 435.47 g/mol. Its IUPAC name is methyl 3-[3-(3-methoxy-3-oxopropoxy)-2-[(3-methoxy-3-oxopropoxy)methyl]-2-(propanoylamino)propoxy]propanoate.
| Compound Name | methyl 3-[3-(3-methoxy-3-oxopropoxy)-2-[(3-methoxy-3-oxopropoxy)methyl]-2-(propanoylamino)propoxy]propanoate |
|---|---|
| PubChem CID | 134401167 |
| Molecular Formula | C19H33NO10 |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | methyl 3-[3-(3-methoxy-3-oxopropoxy)-2-[(3-methoxy-3-oxopropoxy)methyl]-2-(propanoylamino)propoxy]propanoate |
| SMILES | CCC(=O)NC(COCCC(=O)OC)(COCCC(=O)OC)COCCC(=O)OC |
| InChI | InChI=1S/C19H33NO10/c1-5-15(21)20-19(12-28-9-6-16(22)25-2,13-29-10-7-17(23)26-3)14-30-11-8-18(24)27-4/h5-14H2,1-4H3,(H,20,21) |
| InChIKey | DLUODMLFNOCMCD-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|