C17H29NO11 — CID 139426226
3-[3-(2-carboxyethoxy)-2-(2-carboxyethoxymethyl)-2-(3-methoxypropanoylamino)propoxy]propanoic acid (PubChem CID 139426226) has the molecular formula C17H29NO11 and a molecular weight of 423.42 g/mol. Its IUPAC name is 3-[3-(2-carboxyethoxy)-2-(2-carboxyethoxymethyl)-2-(3-methoxypropanoylamino)propoxy]propanoic acid.
| Compound Name | 3-[3-(2-carboxyethoxy)-2-(2-carboxyethoxymethyl)-2-(3-methoxypropanoylamino)propoxy]propanoic acid |
|---|---|
| PubChem CID | 139426226 |
| Molecular Formula | C17H29NO11 |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 3-[3-(2-carboxyethoxy)-2-(2-carboxyethoxymethyl)-2-(3-methoxypropanoylamino)propoxy]propanoic acid |
| SMILES | COCCC(=O)NC(COCCC(=O)O)(COCCC(=O)O)COCCC(=O)O |
| InChI | InChI=1S/C17H29NO11/c1-26-6-2-13(19)18-17(10-27-7-3-14(20)21,11-28-8-4-15(22)23)12-29-9-5-16(24)25/h2-12H2,1H3,(H,18,19)(H,20,21)(H,22,23)(H,24,25) |
| InChIKey | AYOKROSKRLVQJJ-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 177.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|