C18H37NO4S3 — CID 89042887
N-[1,7-bis(sulfanyl)-4-(3-sulfanylpropyl)heptan-4-yl]-3-[2-(2-methoxyethoxy)ethoxy]propanamide (PubChem CID 89042887) has the molecular formula C18H37NO4S3 and a molecular weight of 427.70 g/mol. Its IUPAC name is N-[1,7-bis(sulfanyl)-4-(3-sulfanylpropyl)heptan-4-yl]-3-[2-(2-methoxyethoxy)ethoxy]propanamide.
| Compound Name | N-[1,7-bis(sulfanyl)-4-(3-sulfanylpropyl)heptan-4-yl]-3-[2-(2-methoxyethoxy)ethoxy]propanamide |
|---|---|
| PubChem CID | 89042887 |
| Molecular Formula | C18H37NO4S3 |
| Molecular Weight | 427.70 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | N-[1,7-bis(sulfanyl)-4-(3-sulfanylpropyl)heptan-4-yl]-3-[2-(2-methoxyethoxy)ethoxy]propanamide |
| SMILES | COCCOCCOCCC(=O)NC(CCCS)(CCCS)CCCS |
| InChI | InChI=1S/C18H37NO4S3/c1-21-10-11-23-13-12-22-9-5-17(20)19-18(6-2-14-24,7-3-15-25)8-4-16-26/h24-26H,2-16H2,1H3,(H,19,20) |
| InChIKey | YDSOFFKPXRFLRG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.70 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|