C18H39NO3S3 — CID 91292873
4-[3-[2-(2-methoxyethoxy)ethoxy]propylamino]-4-(3-sulfanylpropyl)heptane-1,7-dithiol (PubChem CID 91292873) has the molecular formula C18H39NO3S3 and a molecular weight of 413.72 g/mol. Its IUPAC name is 4-[3-[2-(2-methoxyethoxy)ethoxy]propylamino]-4-(3-sulfanylpropyl)heptane-1,7-dithiol.
| Compound Name | 4-[3-[2-(2-methoxyethoxy)ethoxy]propylamino]-4-(3-sulfanylpropyl)heptane-1,7-dithiol |
|---|---|
| PubChem CID | 91292873 |
| Molecular Formula | C18H39NO3S3 |
| Molecular Weight | 413.72 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 4-[3-[2-(2-methoxyethoxy)ethoxy]propylamino]-4-(3-sulfanylpropyl)heptane-1,7-dithiol |
| SMILES | COCCOCCOCCCNC(CCCS)(CCCS)CCCS |
| InChI | InChI=1S/C18H39NO3S3/c1-20-11-12-22-14-13-21-10-5-9-19-18(6-2-15-23,7-3-16-24)8-4-17-25/h19,23-25H,2-17H2,1H3 |
| InChIKey | XWYHCJSOJSVYIN-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.72 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|