C15H27NO5 — CID 167221569
N-[1-(4-methyl-3-oxopentoxy)-3-(3-oxobutoxy)propan-2-yl]acetamide (PubChem CID 167221569) has the molecular formula C15H27NO5 and a molecular weight of 301.38 g/mol. Its IUPAC name is N-[1-(4-methyl-3-oxopentoxy)-3-(3-oxobutoxy)propan-2-yl]acetamide.
| Compound Name | N-[1-(4-methyl-3-oxopentoxy)-3-(3-oxobutoxy)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 167221569 |
| Molecular Formula | C15H27NO5 |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | N-[1-(4-methyl-3-oxopentoxy)-3-(3-oxobutoxy)propan-2-yl]acetamide |
| SMILES | CC(=O)CCOCC(COCCC(=O)C(C)C)NC(C)=O |
| InChI | InChI=1S/C15H27NO5/c1-11(2)15(19)6-8-21-10-14(16-13(4)18)9-20-7-5-12(3)17/h11,14H,5-10H2,1-4H3,(H,16,18) |
| InChIKey | RSEDLJBOTRJWBQ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|