C15H28N2O5 — CID 170359530
N-[1,3-bis(3-oxobutoxy)propan-2-yl]-2-(dimethylamino)acetamide (PubChem CID 170359530) has the molecular formula C15H28N2O5 and a molecular weight of 316.40 g/mol. Its IUPAC name is N-[1,3-bis(3-oxobutoxy)propan-2-yl]-2-(dimethylamino)acetamide.
| Compound Name | N-[1,3-bis(3-oxobutoxy)propan-2-yl]-2-(dimethylamino)acetamide |
|---|---|
| PubChem CID | 170359530 |
| Molecular Formula | C15H28N2O5 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | N-[1,3-bis(3-oxobutoxy)propan-2-yl]-2-(dimethylamino)acetamide |
| SMILES | CC(=O)CCOCC(COCCC(C)=O)NC(=O)CN(C)C |
| InChI | InChI=1S/C15H28N2O5/c1-12(18)5-7-21-10-14(11-22-8-6-13(2)19)16-15(20)9-17(3)4/h14H,5-11H2,1-4H3,(H,16,20) |
| InChIKey | QGXXIKWTXASVMA-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|