C12H23NO5 — CID 165351114
2-[2-[2-(2-methylpentanoylamino)ethoxy]ethoxy]acetic acid (PubChem CID 165351114) has the molecular formula C12H23NO5 and a molecular weight of 261.32 g/mol. Its IUPAC name is 2-[2-[2-(2-methylpentanoylamino)ethoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-(2-methylpentanoylamino)ethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 165351114 |
| Molecular Formula | C12H23NO5 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | 2-[2-[2-(2-methylpentanoylamino)ethoxy]ethoxy]acetic acid |
| SMILES | CCCC(C)C(=O)NCCOCCOCC(=O)O |
| InChI | InChI=1S/C12H23NO5/c1-3-4-10(2)12(16)13-5-6-17-7-8-18-9-11(14)15/h10H,3-9H2,1-2H3,(H,13,16)(H,14,15) |
| InChIKey | RHBVFLWTUKNDAT-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|