C19H38N2O6 — CID 170116833
2-[2-[2-(butan-2-ylamino)ethoxy]ethoxy]-N-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethyl]acetamide (PubChem CID 170116833) has the molecular formula C19H38N2O6 and a molecular weight of 390.52 g/mol. Its IUPAC name is 2-[2-[2-(butan-2-ylamino)ethoxy]ethoxy]-N-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethyl]acetamide.
| Compound Name | 2-[2-[2-(butan-2-ylamino)ethoxy]ethoxy]-N-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 170116833 |
| Molecular Formula | C19H38N2O6 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.27 |
| IUPAC Name | 2-[2-[2-(butan-2-ylamino)ethoxy]ethoxy]-N-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethyl]acetamide |
| SMILES | CCC(C)NCCOCCOCC(=O)NCCOCCOCC(=O)C(C)C |
| InChI | InChI=1S/C19H38N2O6/c1-5-17(4)20-6-8-24-11-13-27-15-19(23)21-7-9-25-10-12-26-14-18(22)16(2)3/h16-17,20H,5-15H2,1-4H3,(H,21,23) |
| InChIKey | FDHASSMCEHTJEF-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|