About 2-[(2-bromoacetyl)amino]ethyl 3-ethoxypropanoate
2-[(2-bromoacetyl)amino]ethyl 3-ethoxypropanoate (PubChem CID 175461196) has the molecular formula C9H16BrNO4
and a molecular weight of 282.13 g/mol. Its IUPAC name is 2-[(2-bromoacetyl)amino]ethyl 3-ethoxypropanoate.
Molecular Properties
| Compound Name | 2-[(2-bromoacetyl)amino]ethyl 3-ethoxypropanoate |
| PubChem CID | 175461196 |
| Molecular Formula | C9H16BrNO4 |
| Molecular Weight | 282.13 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | 2-[(2-bromoacetyl)amino]ethyl 3-ethoxypropanoate |
| SMILES | CCOCCC(=O)OCCNC(=O)CBr |
| InChI | InChI=1S/C9H16BrNO4/c1-2-14-5-3-9(13)15-6-4-11-8(12)7-10/h2-7H2,1H3,(H,11,12) |
| InChIKey | PGSNSGYXAQEJQT-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.13 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-bromoacetyl)amino]ethyl 3-ethoxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-bromoacetyl)amino]ethyl 3-ethoxypropanoate?
The IUPAC name of 2-[(2-bromoacetyl)amino]ethyl 3-ethoxypropanoate (CID 175461196) is 2-[(2-bromoacetyl)amino]ethyl 3-ethoxypropanoate.
What is the SMILES notation for 2-[(2-bromoacetyl)amino]ethyl 3-ethoxypropanoate?
The canonical SMILES for 2-[(2-bromoacetyl)amino]ethyl 3-ethoxypropanoate is CCOCCC(=O)OCCNC(=O)CBr.
What is the InChIKey of 2-[(2-bromoacetyl)amino]ethyl 3-ethoxypropanoate?
The InChIKey is PGSNSGYXAQEJQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16BrNO4/c1-2-14-5-3-9(13)15-6-4-11-8(12)7-10/h2-7H2,1H3,(H,11,12).
What are the key properties of 2-[(2-bromoacetyl)amino]ethyl 3-ethoxypropanoate?
2-[(2-bromoacetyl)amino]ethyl 3-ethoxypropanoate has a molecular weight of 282.13 g/mol, XLogP of 0.47, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-bromoacetyl)amino]ethyl 3-ethoxypropanoate is sourced from PubChem (CID 175461196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).