C39H51N3O9 — CID 167312682
tert-butyl N-[2-[2-[2-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]-[2-(2-prop-2-ynoxyethoxy)ethyl]amino]ethoxy]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 167312682) has the molecular formula C39H51N3O9 and a molecular weight of 705.85 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]-[2-(2-prop-2-ynoxyethoxy)ethyl]amino]ethoxy]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]-[2-(2-prop-2-ynoxyethoxy)ethyl]amino]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 167312682 |
| Molecular Formula | C39H51N3O9 |
| Molecular Weight | 705.85 g/mol |
| Exact Mass | 705.36 |
| IUPAC Name | tert-butyl N-[2-[2-[2-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]-[2-(2-prop-2-ynoxyethoxy)ethyl]amino]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | C#CCOCCOCCN(CCOCCOCCOCCNC(=O)OC(C)(C)C)C(=O)CCC(=O)N1Cc2ccccc2C#Cc2ccccc21 |
| InChI | InChI=1S/C39H51N3O9/c1-5-21-46-25-27-48-23-19-41(20-24-49-28-30-50-29-26-47-22-18-40-38(45)51-39(2,3)4)36(43)16-17-37(44)42-31-34-12-7-6-10-32(34)14-15-33-11-8-9-13-35(33)42/h1,6-13H,16-31H2,2-4H3,(H,40,45) |
| InChIKey | VTEBFIREFMKYRI-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 125.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.85 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|