C20H43N2O5S2+ — CID 172812109
dimethyl-[3-[methyl-[2-[2-[2-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]ethoxy]ethoxy]ethyl]amino]propylsulfanyl]sulfanium (PubChem CID 172812109) has the molecular formula C20H43N2O5S2+ and a molecular weight of 455.71 g/mol. Its IUPAC name is dimethyl-[3-[methyl-[2-[2-[2-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]ethoxy]ethoxy]ethyl]amino]propylsulfanyl]sulfanium.
| Compound Name | dimethyl-[3-[methyl-[2-[2-[2-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]ethoxy]ethoxy]ethyl]amino]propylsulfanyl]sulfanium |
|---|---|
| PubChem CID | 172812109 |
| Molecular Formula | C20H43N2O5S2+ |
| Molecular Weight | 455.71 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | dimethyl-[3-[methyl-[2-[2-[2-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]ethoxy]ethoxy]ethyl]amino]propylsulfanyl]sulfanium |
| SMILES | CN(CCCS[S+](C)C)CCOCCOCCOCCN(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H43N2O5S2/c1-20(2,3)27-19(23)22(5)11-13-25-15-17-26-16-14-24-12-10-21(4)9-8-18-28-29(6)7/h8-18H2,1-7H3/q+1 |
| InChIKey | SHXHBPWAOHADPK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.71 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|