C11H22BrNO4 — CID 130301243
tert-butyl N-[2-(2-bromoethoxy)ethoxy]-N-ethylcarbamate (PubChem CID 130301243) has the molecular formula C11H22BrNO4 and a molecular weight of 312.20 g/mol. Its IUPAC name is tert-butyl N-[2-(2-bromoethoxy)ethoxy]-N-ethylcarbamate.
| Compound Name | tert-butyl N-[2-(2-bromoethoxy)ethoxy]-N-ethylcarbamate |
|---|---|
| PubChem CID | 130301243 |
| Molecular Formula | C11H22BrNO4 |
| Molecular Weight | 312.20 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | tert-butyl N-[2-(2-bromoethoxy)ethoxy]-N-ethylcarbamate |
| SMILES | CCN(OCCOCCBr)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H22BrNO4/c1-5-13(10(14)17-11(2,3)4)16-9-8-15-7-6-12/h5-9H2,1-4H3 |
| InChIKey | OLRAHCQEXZXFES-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.20 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|