C18H33NO6 — CID 163816956
4-O-[2-[2-(2-aminopropan-2-yl)-2,4,4-trimethylpentanoyl]oxyethyl] 1-O-methyl butanedioate (PubChem CID 163816956) has the molecular formula C18H33NO6 and a molecular weight of 359.46 g/mol. Its IUPAC name is 4-O-[2-[2-(2-aminopropan-2-yl)-2,4,4-trimethylpentanoyl]oxyethyl] 1-O-methyl butanedioate.
| Compound Name | 4-O-[2-[2-(2-aminopropan-2-yl)-2,4,4-trimethylpentanoyl]oxyethyl] 1-O-methyl butanedioate |
|---|---|
| PubChem CID | 163816956 |
| Molecular Formula | C18H33NO6 |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | 4-O-[2-[2-(2-aminopropan-2-yl)-2,4,4-trimethylpentanoyl]oxyethyl] 1-O-methyl butanedioate |
| SMILES | COC(=O)CCC(=O)OCCOC(=O)C(C)(CC(C)(C)C)C(C)(C)N |
| InChI | InChI=1S/C18H33NO6/c1-16(2,3)12-18(6,17(4,5)19)15(22)25-11-10-24-14(21)9-8-13(20)23-7/h8-12,19H2,1-7H3 |
| InChIKey | NSDUXCPPOOWIHE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|