C28H54N2O6S — CID 143767433
1-O-(2-aminoethyl) 7-O-ethyl 6-(2-aminopropan-2-yl)-2-[2-(3-methoxy-3-oxopropyl)sulfanyl-2-methylpropyl]-2,3,3,4,4,6-hexamethylheptanedioate (PubChem CID 143767433) has the molecular formula C28H54N2O6S and a molecular weight of 546.82 g/mol. Its IUPAC name is 1-O-(2-aminoethyl) 7-O-ethyl 6-(2-aminopropan-2-yl)-2-[2-(3-methoxy-3-oxopropyl)sulfanyl-2-methylpropyl]-2,3,3,4,4,6-hexamethylheptanedioate.
| Compound Name | 1-O-(2-aminoethyl) 7-O-ethyl 6-(2-aminopropan-2-yl)-2-[2-(3-methoxy-3-oxopropyl)sulfanyl-2-methylpropyl]-2,3,3,4,4,6-hexamethylheptanedioate |
|---|---|
| PubChem CID | 143767433 |
| Molecular Formula | C28H54N2O6S |
| Molecular Weight | 546.82 g/mol |
| Exact Mass | 546.37 |
| IUPAC Name | 1-O-(2-aminoethyl) 7-O-ethyl 6-(2-aminopropan-2-yl)-2-[2-(3-methoxy-3-oxopropyl)sulfanyl-2-methylpropyl]-2,3,3,4,4,6-hexamethylheptanedioate |
| SMILES | CCOC(=O)C(C)(CC(C)(C)C(C)(C)C(C)(CC(C)(C)SCCC(=O)OC)C(=O)OCCN)C(C)(C)N |
| InChI | InChI=1S/C28H54N2O6S/c1-13-35-22(33)28(11,26(8,9)30)18-23(2,3)25(6,7)27(10,21(32)36-16-15-29)19-24(4,5)37-17-14-20(31)34-12/h13-19,29-30H2,1-12H3 |
| InChIKey | CVAMMKLQZRVYMI-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 130.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.82 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|