C16H30O3S2 — CID 118153099
3-(4-methoxycarbonyl-2,4,5,5-tetramethylheptan-2-yl)sulfanylpropanethioic S-acid (PubChem CID 118153099) has the molecular formula C16H30O3S2 and a molecular weight of 334.55 g/mol. Its IUPAC name is 3-(4-methoxycarbonyl-2,4,5,5-tetramethylheptan-2-yl)sulfanylpropanethioic S-acid.
| Compound Name | 3-(4-methoxycarbonyl-2,4,5,5-tetramethylheptan-2-yl)sulfanylpropanethioic S-acid |
|---|---|
| PubChem CID | 118153099 |
| Molecular Formula | C16H30O3S2 |
| Molecular Weight | 334.55 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 3-(4-methoxycarbonyl-2,4,5,5-tetramethylheptan-2-yl)sulfanylpropanethioic S-acid |
| SMILES | CCC(C)(C)C(C)(CC(C)(C)SCCC(=O)S)C(=O)OC |
| InChI | InChI=1S/C16H30O3S2/c1-8-14(2,3)16(6,13(18)19-7)11-15(4,5)21-10-9-12(17)20/h8-11H2,1-7H3,(H,17,20) |
| InChIKey | CQIHGQWDOYIZRI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 43.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.55 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|