C10H21IN2O2 — CID 137412560
methyl 4-amino-2-(1-amino-1-iodoethyl)-2,4-dimethylpentanoate (PubChem CID 137412560) has the molecular formula C10H21IN2O2 and a molecular weight of 328.19 g/mol. Its IUPAC name is methyl 4-amino-2-(1-amino-1-iodoethyl)-2,4-dimethylpentanoate.
| Compound Name | methyl 4-amino-2-(1-amino-1-iodoethyl)-2,4-dimethylpentanoate |
|---|---|
| PubChem CID | 137412560 |
| Molecular Formula | C10H21IN2O2 |
| Molecular Weight | 328.19 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | methyl 4-amino-2-(1-amino-1-iodoethyl)-2,4-dimethylpentanoate |
| SMILES | COC(=O)C(C)(CC(C)(C)N)C(C)(N)I |
| InChI | InChI=1S/C10H21IN2O2/c1-8(2,12)6-9(3,7(14)15-5)10(4,11)13/h6,12-13H2,1-5H3 |
| InChIKey | CBQWCMBIKFFBAA-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.19 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|