C17H31NO5 — CID 144924237
2-(3-oxobutanoyloxy)ethyl 4-amino-2-tert-butyl-2,4-dimethylpentanoate (PubChem CID 144924237) has the molecular formula C17H31NO5 and a molecular weight of 329.44 g/mol. Its IUPAC name is 2-(3-oxobutanoyloxy)ethyl 4-amino-2-tert-butyl-2,4-dimethylpentanoate.
| Compound Name | 2-(3-oxobutanoyloxy)ethyl 4-amino-2-tert-butyl-2,4-dimethylpentanoate |
|---|---|
| PubChem CID | 144924237 |
| Molecular Formula | C17H31NO5 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | 2-(3-oxobutanoyloxy)ethyl 4-amino-2-tert-butyl-2,4-dimethylpentanoate |
| SMILES | CC(=O)CC(=O)OCCOC(=O)C(C)(CC(C)(C)N)C(C)(C)C |
| InChI | InChI=1S/C17H31NO5/c1-12(19)10-13(20)22-8-9-23-14(21)17(7,15(2,3)4)11-16(5,6)18/h8-11,18H2,1-7H3 |
| InChIKey | FWZOBPVCKACJMN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|