C17H30O5 — CID 89143249
2-(3-oxobutanoyloxy)ethyl 2-tert-butyl-2,4-dimethylpentanoate (PubChem CID 89143249) has the molecular formula C17H30O5 and a molecular weight of 314.42 g/mol. Its IUPAC name is 2-(3-oxobutanoyloxy)ethyl 2-tert-butyl-2,4-dimethylpentanoate.
| Compound Name | 2-(3-oxobutanoyloxy)ethyl 2-tert-butyl-2,4-dimethylpentanoate |
|---|---|
| PubChem CID | 89143249 |
| Molecular Formula | C17H30O5 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 2-(3-oxobutanoyloxy)ethyl 2-tert-butyl-2,4-dimethylpentanoate |
| SMILES | CC(=O)CC(=O)OCCOC(=O)C(C)(CC(C)C)C(C)(C)C |
| InChI | InChI=1S/C17H30O5/c1-12(2)11-17(7,16(4,5)6)15(20)22-9-8-21-14(19)10-13(3)18/h12H,8-11H2,1-7H3 |
| InChIKey | OHTAJKRGQUZVSH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|