C10H12F10O4 — CID 160970563
1-ethoxy-2,2,3,3,3-pentafluoropropan-1-ol;ethyl 2,2,3,3,3-pentafluoropropanoate (PubChem CID 160970563) has the molecular formula C10H12F10O4 and a molecular weight of 386.18 g/mol. Its IUPAC name is 1-ethoxy-2,2,3,3,3-pentafluoropropan-1-ol;ethyl 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | 1-ethoxy-2,2,3,3,3-pentafluoropropan-1-ol;ethyl 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 160970563 |
| Molecular Formula | C10H12F10O4 |
| Molecular Weight | 386.18 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 1-ethoxy-2,2,3,3,3-pentafluoropropan-1-ol;ethyl 2,2,3,3,3-pentafluoropropanoate |
| SMILES | CCOC(=O)C(F)(F)C(F)(F)F.CCOC(O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5H7F5O2.C5H5F5O2/c2*1-2-12-3(11)4(6,7)5(8,9)10/h3,11H,2H2,1H3;2H2,1H3 |
| InChIKey | SYEVPIMLMLAFNU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.18 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|