About carbanide;heptane-3,5-dione;platinum(4+)
carbanide;heptane-3,5-dione;platinum(4+) (PubChem CID 174221108) has the molecular formula C10H20O2Pt
and a molecular weight of 367.35 g/mol. Its IUPAC name is carbanide;heptane-3,5-dione;platinum(4+).
Molecular Properties
| Compound Name | carbanide;heptane-3,5-dione;platinum(4+) |
| PubChem CID | 174221108 |
| Molecular Formula | C10H20O2Pt |
| Molecular Weight | 367.35 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | carbanide;heptane-3,5-dione;platinum(4+) |
| SMILES | [CH2-]CC(=O)CC(=O)CC.[CH3-].[CH3-].[CH3-].[Pt+4] |
| InChI | InChI=1S/C7H11O2.3CH3.Pt/c1-3-6(8)5-7(9)4-2;;;;/h1,3-5H2,2H3;3*1H3;/q4*-1;+4 |
| InChIKey | RTNZNMYPMVWHPK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;heptane-3,5-dione;platinum(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;heptane-3,5-dione;platinum(4+)?
The IUPAC name of carbanide;heptane-3,5-dione;platinum(4+) (CID 174221108) is carbanide;heptane-3,5-dione;platinum(4+).
What is the SMILES notation for carbanide;heptane-3,5-dione;platinum(4+)?
The canonical SMILES for carbanide;heptane-3,5-dione;platinum(4+) is [CH2-]CC(=O)CC(=O)CC.[CH3-].[CH3-].[CH3-].[Pt+4].
What is the InChIKey of carbanide;heptane-3,5-dione;platinum(4+)?
The InChIKey is RTNZNMYPMVWHPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11O2.3CH3.Pt/c1-3-6(8)5-7(9)4-2;;;;/h1,3-5H2,2H3;3*1H3;/q4*-1;+4.
What are the key properties of carbanide;heptane-3,5-dione;platinum(4+)?
carbanide;heptane-3,5-dione;platinum(4+) has a molecular weight of 367.35 g/mol, XLogP of 2.50, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;heptane-3,5-dione;platinum(4+) is sourced from PubChem (CID 174221108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).