About 3-oxopentanoyl 3-oxopentaneperoxoate
3-oxopentanoyl 3-oxopentaneperoxoate (PubChem CID 175002587) has the molecular formula C10H14O6
and a molecular weight of 230.22 g/mol. Its IUPAC name is 3-oxopentanoyl 3-oxopentaneperoxoate.
Molecular Properties
| Compound Name | 3-oxopentanoyl 3-oxopentaneperoxoate |
| PubChem CID | 175002587 |
| Molecular Formula | C10H14O6 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 3-oxopentanoyl 3-oxopentaneperoxoate |
| SMILES | CCC(=O)CC(=O)OOC(=O)CC(=O)CC |
| InChI | InChI=1S/C10H14O6/c1-3-7(11)5-9(13)15-16-10(14)6-8(12)4-2/h3-6H2,1-2H3 |
| InChIKey | CSZOBGZVIWLQHG-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3-oxopentanoyl 3-oxopentaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxopentanoyl 3-oxopentaneperoxoate?
The IUPAC name of 3-oxopentanoyl 3-oxopentaneperoxoate (CID 175002587) is 3-oxopentanoyl 3-oxopentaneperoxoate.
What is the SMILES notation for 3-oxopentanoyl 3-oxopentaneperoxoate?
The canonical SMILES for 3-oxopentanoyl 3-oxopentaneperoxoate is CCC(=O)CC(=O)OOC(=O)CC(=O)CC.
What is the InChIKey of 3-oxopentanoyl 3-oxopentaneperoxoate?
The InChIKey is CSZOBGZVIWLQHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O6/c1-3-7(11)5-9(13)15-16-10(14)6-8(12)4-2/h3-6H2,1-2H3.
What are the key properties of 3-oxopentanoyl 3-oxopentaneperoxoate?
3-oxopentanoyl 3-oxopentaneperoxoate has a molecular weight of 230.22 g/mol, XLogP of 0.73, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxopentanoyl 3-oxopentaneperoxoate is sourced from PubChem (CID 175002587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).