C18H32O4-2 — CID 167615022
6-(5,5-dimethyl-6-oxidohept-6-enoxy)-2,2,5-trimethylhexanoate (PubChem CID 167615022) has the molecular formula C18H32O4-2 and a molecular weight of 312.45 g/mol. Its IUPAC name is 6-(5,5-dimethyl-6-oxidohept-6-enoxy)-2,2,5-trimethylhexanoate.
| Compound Name | 6-(5,5-dimethyl-6-oxidohept-6-enoxy)-2,2,5-trimethylhexanoate |
|---|---|
| PubChem CID | 167615022 |
| Molecular Formula | C18H32O4-2 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | 6-(5,5-dimethyl-6-oxidohept-6-enoxy)-2,2,5-trimethylhexanoate |
| SMILES | C=C([O-])C(C)(C)CCCCOCC(C)CCC(C)(C)C(=O)[O-] |
| InChI | InChI=1S/C18H34O4/c1-14(9-11-18(5,6)16(20)21)13-22-12-8-7-10-17(3,4)15(2)19/h14,19H,2,7-13H2,1,3-6H3,(H,20,21)/p-2 |
| InChIKey | LPSJHOGVGLVQFK-UHFFFAOYSA-L |
| XLogP | 2.27 |
| TPSA | 72.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|