C10H22O7 — CID 87378318
5-(5,5,5-trihydroxypentoxy)pentane-1,1,1-triol (PubChem CID 87378318) has the molecular formula C10H22O7 and a molecular weight of 254.28 g/mol. Its IUPAC name is 5-(5,5,5-trihydroxypentoxy)pentane-1,1,1-triol.
| Compound Name | 5-(5,5,5-trihydroxypentoxy)pentane-1,1,1-triol |
|---|---|
| PubChem CID | 87378318 |
| Molecular Formula | C10H22O7 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 5-(5,5,5-trihydroxypentoxy)pentane-1,1,1-triol |
| SMILES | OC(O)(O)CCCCOCCCCC(O)(O)O |
| InChI | InChI=1S/C10H22O7/c11-9(12,13)5-1-3-7-17-8-4-2-6-10(14,15)16/h11-16H,1-8H2 |
| InChIKey | PAUTULAWMQOHBV-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|