C19H39O9P2- — CID 59125127
(2,2,14,14-tetramethyl-8-oxo-15-phosphonooxypentadecyl) hydrogen phosphate (PubChem CID 59125127) has the molecular formula C19H39O9P2- and a molecular weight of 473.46 g/mol. Its IUPAC name is (2,2,14,14-tetramethyl-8-oxo-15-phosphonooxypentadecyl) hydrogen phosphate.
| Compound Name | (2,2,14,14-tetramethyl-8-oxo-15-phosphonooxypentadecyl) hydrogen phosphate |
|---|---|
| PubChem CID | 59125127 |
| Molecular Formula | C19H39O9P2- |
| Molecular Weight | 473.46 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | (2,2,14,14-tetramethyl-8-oxo-15-phosphonooxypentadecyl) hydrogen phosphate |
| SMILES | CC(C)(CCCCCC(=O)CCCCCC(C)(C)COP(=O)(O)O)COP(=O)([O-])O |
| InChI | InChI=1S/C19H40O9P2/c1-18(2,15-27-29(21,22)23)13-9-5-7-11-17(20)12-8-6-10-14-19(3,4)16-28-30(24,25)26/h5-16H2,1-4H3,(H2,21,22,23)(H2,24,25,26)/p-1 |
| InChIKey | PPEAKKNTWHXWQP-UHFFFAOYSA-M |
| XLogP | 4.10 |
| TPSA | 153.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|