C21H45O7P — CID 139533089
tris(5-hydroxy-3,3-dimethylpentyl) phosphate (PubChem CID 139533089) has the molecular formula C21H45O7P and a molecular weight of 440.56 g/mol. Its IUPAC name is tris(5-hydroxy-3,3-dimethylpentyl) phosphate.
| Compound Name | tris(5-hydroxy-3,3-dimethylpentyl) phosphate |
|---|---|
| PubChem CID | 139533089 |
| Molecular Formula | C21H45O7P |
| Molecular Weight | 440.56 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | tris(5-hydroxy-3,3-dimethylpentyl) phosphate |
| SMILES | CC(C)(CCO)CCOP(=O)(OCCC(C)(C)CCO)OCCC(C)(C)CCO |
| InChI | InChI=1S/C21H45O7P/c1-19(2,7-13-22)10-16-26-29(25,27-17-11-20(3,4)8-14-23)28-18-12-21(5,6)9-15-24/h22-24H,7-18H2,1-6H3 |
| InChIKey | YXJYSFCVSCUEEH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.56 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|