C18H24F15O4P — CID 139789248
tris(3,3,6,6,6-pentafluorohexyl) phosphate (PubChem CID 139789248) has the molecular formula C18H24F15O4P and a molecular weight of 620.33 g/mol. Its IUPAC name is tris(3,3,6,6,6-pentafluorohexyl) phosphate.
| Compound Name | tris(3,3,6,6,6-pentafluorohexyl) phosphate |
|---|---|
| PubChem CID | 139789248 |
| Molecular Formula | C18H24F15O4P |
| Molecular Weight | 620.33 g/mol |
| Exact Mass | 620.12 |
| IUPAC Name | tris(3,3,6,6,6-pentafluorohexyl) phosphate |
| SMILES | O=P(OCCC(F)(F)CCC(F)(F)F)(OCCC(F)(F)CCC(F)(F)F)OCCC(F)(F)CCC(F)(F)F |
| InChI | InChI=1S/C18H24F15O4P/c19-13(20,1-4-16(25,26)27)7-10-35-38(34,36-11-8-14(21,22)2-5-17(28,29)30)37-12-9-15(23,24)3-6-18(31,32)33/h1-12H2 |
| InChIKey | BEBNJASDHBVURL-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.33 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|