C6H15NaO8P2 — CID 174569917
sodium;hydride;6-oxohexyl phosphono hydrogen phosphate (PubChem CID 174569917) has the molecular formula C6H15NaO8P2 and a molecular weight of 300.12 g/mol. Its IUPAC name is sodium;hydride;6-oxohexyl phosphono hydrogen phosphate.
| Compound Name | sodium;hydride;6-oxohexyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 174569917 |
| Molecular Formula | C6H15NaO8P2 |
| Molecular Weight | 300.12 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | sodium;hydride;6-oxohexyl phosphono hydrogen phosphate |
| SMILES | O=CCCCCCOP(=O)(O)OP(=O)(O)O.[H-].[Na+] |
| InChI | InChI=1S/C6H14O8P2.Na.H/c7-5-3-1-2-4-6-13-16(11,12)14-15(8,9)10;;/h5H,1-4,6H2,(H,11,12)(H2,8,9,10);;/q;+1;-1 |
| InChIKey | MEZPASYMWIOBIK-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.12 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|