C13H26O9P2 — CID 150866761
9-[hydroxy(phosphonooxy)phosphoryl]oxynonyl but-2-enoate (PubChem CID 150866761) has the molecular formula C13H26O9P2 and a molecular weight of 388.29 g/mol. Its IUPAC name is 9-[hydroxy(phosphonooxy)phosphoryl]oxynonyl but-2-enoate.
| Compound Name | 9-[hydroxy(phosphonooxy)phosphoryl]oxynonyl but-2-enoate |
|---|---|
| PubChem CID | 150866761 |
| Molecular Formula | C13H26O9P2 |
| Molecular Weight | 388.29 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 9-[hydroxy(phosphonooxy)phosphoryl]oxynonyl but-2-enoate |
| SMILES | CC=CC(=O)OCCCCCCCCCOP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C13H26O9P2/c1-2-10-13(14)20-11-8-6-4-3-5-7-9-12-21-24(18,19)22-23(15,16)17/h2,10H,3-9,11-12H2,1H3,(H,18,19)(H2,15,16,17) |
| InChIKey | KTFFYNMPNJAZRM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.29 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|