About 7-trichlorosilylheptyl but-2-enoate
7-trichlorosilylheptyl but-2-enoate (PubChem CID 174106010) has the molecular formula C11H19Cl3O2Si
and a molecular weight of 317.72 g/mol. Its IUPAC name is 7-trichlorosilylheptyl but-2-enoate.
Molecular Properties
| Compound Name | 7-trichlorosilylheptyl but-2-enoate |
| PubChem CID | 174106010 |
| Molecular Formula | C11H19Cl3O2Si |
| Molecular Weight | 317.72 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 7-trichlorosilylheptyl but-2-enoate |
| SMILES | CC=CC(=O)OCCCCCCC[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/C11H19Cl3O2Si/c1-2-8-11(15)16-9-6-4-3-5-7-10-17(12,13)14/h2,8H,3-7,9-10H2,1H3 |
| InChIKey | FPTYZRCIIGSHAQ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.72 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze 7-trichlorosilylheptyl but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-trichlorosilylheptyl but-2-enoate?
The IUPAC name of 7-trichlorosilylheptyl but-2-enoate (CID 174106010) is 7-trichlorosilylheptyl but-2-enoate.
What is the SMILES notation for 7-trichlorosilylheptyl but-2-enoate?
The canonical SMILES for 7-trichlorosilylheptyl but-2-enoate is CC=CC(=O)OCCCCCCC[Si](Cl)(Cl)Cl.
What is the InChIKey of 7-trichlorosilylheptyl but-2-enoate?
The InChIKey is FPTYZRCIIGSHAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19Cl3O2Si/c1-2-8-11(15)16-9-6-4-3-5-7-10-17(12,13)14/h2,8H,3-7,9-10H2,1H3.
What are the key properties of 7-trichlorosilylheptyl but-2-enoate?
7-trichlorosilylheptyl but-2-enoate has a molecular weight of 317.72 g/mol, XLogP of 4.71, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-trichlorosilylheptyl but-2-enoate is sourced from PubChem (CID 174106010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).