About 5-[chloro(dimethyl)silyl]pentyl but-2-enoate
5-[chloro(dimethyl)silyl]pentyl but-2-enoate (PubChem CID 174106073) has the molecular formula C11H21ClO2Si
and a molecular weight of 248.83 g/mol. Its IUPAC name is 5-[chloro(dimethyl)silyl]pentyl but-2-enoate.
Molecular Properties
| Compound Name | 5-[chloro(dimethyl)silyl]pentyl but-2-enoate |
| PubChem CID | 174106073 |
| Molecular Formula | C11H21ClO2Si |
| Molecular Weight | 248.83 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 5-[chloro(dimethyl)silyl]pentyl but-2-enoate |
| SMILES | CC=CC(=O)OCCCCC[Si](C)(C)Cl |
| InChI | InChI=1S/C11H21ClO2Si/c1-4-8-11(13)14-9-6-5-7-10-15(2,3)12/h4,8H,5-7,9-10H2,1-3H3 |
| InChIKey | IKZBYZKUNDNLLQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.83 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze 5-[chloro(dimethyl)silyl]pentyl but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[chloro(dimethyl)silyl]pentyl but-2-enoate?
The IUPAC name of 5-[chloro(dimethyl)silyl]pentyl but-2-enoate (CID 174106073) is 5-[chloro(dimethyl)silyl]pentyl but-2-enoate.
What is the SMILES notation for 5-[chloro(dimethyl)silyl]pentyl but-2-enoate?
The canonical SMILES for 5-[chloro(dimethyl)silyl]pentyl but-2-enoate is CC=CC(=O)OCCCCC[Si](C)(C)Cl.
What is the InChIKey of 5-[chloro(dimethyl)silyl]pentyl but-2-enoate?
The InChIKey is IKZBYZKUNDNLLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21ClO2Si/c1-4-8-11(13)14-9-6-5-7-10-15(2,3)12/h4,8H,5-7,9-10H2,1-3H3.
What are the key properties of 5-[chloro(dimethyl)silyl]pentyl but-2-enoate?
5-[chloro(dimethyl)silyl]pentyl but-2-enoate has a molecular weight of 248.83 g/mol, XLogP of 3.72, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[chloro(dimethyl)silyl]pentyl but-2-enoate is sourced from PubChem (CID 174106073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).