C5H15BrO8P2 — CID 5289334
(3-hydroxy-3-methylbutyl) phosphono hydrogen phosphate;hydrobromide (PubChem CID 5289334) has the molecular formula C5H15BrO8P2 and a molecular weight of 345.02 g/mol. Its IUPAC name is (3-hydroxy-3-methylbutyl) phosphono hydrogen phosphate;hydrobromide.
| Compound Name | (3-hydroxy-3-methylbutyl) phosphono hydrogen phosphate;hydrobromide |
|---|---|
| PubChem CID | 5289334 |
| Molecular Formula | C5H15BrO8P2 |
| Molecular Weight | 345.02 g/mol |
| Exact Mass | 343.94 |
| IUPAC Name | (3-hydroxy-3-methylbutyl) phosphono hydrogen phosphate;hydrobromide |
| SMILES | Br.CC(C)(O)CCOP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C5H14O8P2.BrH/c1-5(2,6)3-4-12-15(10,11)13-14(7,8)9;/h6H,3-4H2,1-2H3,(H,10,11)(H2,7,8,9);1H |
| InChIKey | ZGCIEBLSHCIDAP-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.02 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|