C10H21LiO11P2 — CID 23676500
lithium 3,5-dihydroxy-9-[hydroxy(phosphonooxy)phosphoryl]oxy-3-methylnonanoate (PubChem CID 23676500) has the molecular formula C10H21LiO11P2 and a molecular weight of 386.16 g/mol. Its IUPAC name is lithium 3,5-dihydroxy-9-[hydroxy(phosphonooxy)phosphoryl]oxy-3-methylnonanoate.
| Compound Name | lithium 3,5-dihydroxy-9-[hydroxy(phosphonooxy)phosphoryl]oxy-3-methylnonanoate |
|---|---|
| PubChem CID | 23676500 |
| Molecular Formula | C10H21LiO11P2 |
| Molecular Weight | 386.16 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | lithium 3,5-dihydroxy-9-[hydroxy(phosphonooxy)phosphoryl]oxy-3-methylnonanoate |
| SMILES | CC(O)(CC(=O)[O-])CC(O)CCCCOP(=O)(O)OP(=O)(O)O.[Li+] |
| InChI | InChI=1S/C10H22O11P2.Li/c1-10(14,7-9(12)13)6-8(11)4-2-3-5-20-23(18,19)21-22(15,16)17;/h8,11,14H,2-7H2,1H3,(H,12,13)(H,18,19)(H2,15,16,17);/q;+1/p-1 |
| InChIKey | UCLBHKYZOYPPHL-UHFFFAOYSA-M |
| XLogP | -3.97 |
| TPSA | 193.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.16 |
| LogP ≤ 5 | -3.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|