C8H18O7P2 — CID 102509629
[(Z)-3-methylhept-3-enyl] phosphono hydrogen phosphate (PubChem CID 102509629) has the molecular formula C8H18O7P2 and a molecular weight of 288.17 g/mol. Its IUPAC name is [(Z)-3-methylhept-3-enyl] phosphono hydrogen phosphate.
| Compound Name | [(Z)-3-methylhept-3-enyl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 102509629 |
| Molecular Formula | C8H18O7P2 |
| Molecular Weight | 288.17 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | [(Z)-3-methylhept-3-enyl] phosphono hydrogen phosphate |
| SMILES | CCC/C=C(/C)CCOP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C8H18O7P2/c1-3-4-5-8(2)6-7-14-17(12,13)15-16(9,10)11/h5H,3-4,6-7H2,1-2H3,(H,12,13)(H2,9,10,11)/b8-5- |
| InChIKey | BZFPEUCNGUVBIW-YVMONPNESA-N |
| XLogP | 2.35 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.17 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|