C8H16O12P2 — CID 88511173
[(2R,3S)-2-hydroxy-5-oxo-1-phosphonooxypentan-3-yl] (2-hydroxy-3-oxopropyl) hydrogen phosphate (PubChem CID 88511173) has the molecular formula C8H16O12P2 and a molecular weight of 366.15 g/mol. Its IUPAC name is [(2R,3S)-2-hydroxy-5-oxo-1-phosphonooxypentan-3-yl] (2-hydroxy-3-oxopropyl) hydrogen phosphate.
| Compound Name | [(2R,3S)-2-hydroxy-5-oxo-1-phosphonooxypentan-3-yl] (2-hydroxy-3-oxopropyl) hydrogen phosphate |
|---|---|
| PubChem CID | 88511173 |
| Molecular Formula | C8H16O12P2 |
| Molecular Weight | 366.15 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | [(2R,3S)-2-hydroxy-5-oxo-1-phosphonooxypentan-3-yl] (2-hydroxy-3-oxopropyl) hydrogen phosphate |
| SMILES | O=CC[C@H](OP(=O)(O)OCC(O)C=O)[C@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C8H16O12P2/c9-2-1-8(7(12)5-18-21(13,14)15)20-22(16,17)19-4-6(11)3-10/h2-3,6-8,11-12H,1,4-5H2,(H,16,17)(H2,13,14,15)/t6?,7-,8+/m1/s1 |
| InChIKey | CEHIFDHYPSRZAX-VVXQKDJTSA-N |
| XLogP | -1.89 |
| TPSA | 197.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.15 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|