C6H12O13P2 — CID 102444963
(2R,4R)-2,4-dihydroxy-3-oxo-5-phosphonooxy-2-(phosphonooxymethyl)pentanoic acid (PubChem CID 102444963) has the molecular formula C6H12O13P2 and a molecular weight of 354.10 g/mol. Its IUPAC name is (2R,4R)-2,4-dihydroxy-3-oxo-5-phosphonooxy-2-(phosphonooxymethyl)pentanoic acid.
| Compound Name | (2R,4R)-2,4-dihydroxy-3-oxo-5-phosphonooxy-2-(phosphonooxymethyl)pentanoic acid |
|---|---|
| PubChem CID | 102444963 |
| Molecular Formula | C6H12O13P2 |
| Molecular Weight | 354.10 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | (2R,4R)-2,4-dihydroxy-3-oxo-5-phosphonooxy-2-(phosphonooxymethyl)pentanoic acid |
| SMILES | O=C(O)[C@@](O)(COP(=O)(O)O)C(=O)[C@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C6H12O13P2/c7-3(1-18-20(12,13)14)4(8)6(11,5(9)10)2-19-21(15,16)17/h3,7,11H,1-2H2,(H,9,10)(H2,12,13,14)(H2,15,16,17)/t3-,6-/m1/s1 |
| InChIKey | DUTQDHZZJUGPFV-AWFVSMACSA-N |
| XLogP | -3.05 |
| TPSA | 228.35 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.10 |
| LogP ≤ 5 | -3.05 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|