C6H14NO7P — CID 57085097
4-hydroxy-3-(methylamino)-5-phosphonooxypentanoic acid (PubChem CID 57085097) has the molecular formula C6H14NO7P and a molecular weight of 243.15 g/mol. Its IUPAC name is 4-hydroxy-3-(methylamino)-5-phosphonooxypentanoic acid.
| Compound Name | 4-hydroxy-3-(methylamino)-5-phosphonooxypentanoic acid |
|---|---|
| PubChem CID | 57085097 |
| Molecular Formula | C6H14NO7P |
| Molecular Weight | 243.15 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 4-hydroxy-3-(methylamino)-5-phosphonooxypentanoic acid |
| SMILES | CNC(CC(=O)O)C(O)COP(=O)(O)O |
| InChI | InChI=1S/C6H14NO7P/c1-7-4(2-6(9)10)5(8)3-14-15(11,12)13/h4-5,7-8H,2-3H2,1H3,(H,9,10)(H2,11,12,13) |
| InChIKey | DNEKODLDADUWNI-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.15 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|