C14H31O11P — CID 175553012
2-ethylhexan-1-ol;2,3,4,5-tetrahydroxy-6-phosphonooxyhexanoic acid (PubChem CID 175553012) has the molecular formula C14H31O11P and a molecular weight of 406.37 g/mol. Its IUPAC name is 2-ethylhexan-1-ol;2,3,4,5-tetrahydroxy-6-phosphonooxyhexanoic acid.
| Compound Name | 2-ethylhexan-1-ol;2,3,4,5-tetrahydroxy-6-phosphonooxyhexanoic acid |
|---|---|
| PubChem CID | 175553012 |
| Molecular Formula | C14H31O11P |
| Molecular Weight | 406.37 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 2-ethylhexan-1-ol;2,3,4,5-tetrahydroxy-6-phosphonooxyhexanoic acid |
| SMILES | CCCCC(CC)CO.O=C(O)C(O)C(O)C(O)C(O)COP(=O)(O)O |
| InChI | InChI=1S/C8H18O.C6H13O10P/c1-3-5-6-8(4-2)7-9;7-2(1-16-17(13,14)15)3(8)4(9)5(10)6(11)12/h8-9H,3-7H2,1-2H3;2-5,7-10H,1H2,(H,11,12)(H2,13,14,15) |
| InChIKey | SZFJFCWPSQMFNO-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 205.21 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.37 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|