C12H23ClO9 — CID 174944644
2-chlorohexanoic acid;2,3,4,5,6-pentahydroxyhexanoic acid (PubChem CID 174944644) has the molecular formula C12H23ClO9 and a molecular weight of 346.76 g/mol. Its IUPAC name is 2-chlorohexanoic acid;2,3,4,5,6-pentahydroxyhexanoic acid.
| Compound Name | 2-chlorohexanoic acid;2,3,4,5,6-pentahydroxyhexanoic acid |
|---|---|
| PubChem CID | 174944644 |
| Molecular Formula | C12H23ClO9 |
| Molecular Weight | 346.76 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 2-chlorohexanoic acid;2,3,4,5,6-pentahydroxyhexanoic acid |
| SMILES | CCCCC(Cl)C(=O)O.O=C(O)C(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C6H11ClO2.C6H12O7/c1-2-3-4-5(7)6(8)9;7-1-2(8)3(9)4(10)5(11)6(12)13/h5H,2-4H2,1H3,(H,8,9);2-5,7-11H,1H2,(H,12,13) |
| InChIKey | AHIHJVOISMWKBJ-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 175.75 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.76 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|