C6H13O7PS — CID 118130816
[(3R,4R,5R)-4,5,6-trihydroxy-2-sulfanylidenehexan-3-yl] dihydrogen phosphate (PubChem CID 118130816) has the molecular formula C6H13O7PS and a molecular weight of 260.20 g/mol. Its IUPAC name is [(3R,4R,5R)-4,5,6-trihydroxy-2-sulfanylidenehexan-3-yl] dihydrogen phosphate.
| Compound Name | [(3R,4R,5R)-4,5,6-trihydroxy-2-sulfanylidenehexan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 118130816 |
| Molecular Formula | C6H13O7PS |
| Molecular Weight | 260.20 g/mol |
| Exact Mass | 260.01 |
| IUPAC Name | [(3R,4R,5R)-4,5,6-trihydroxy-2-sulfanylidenehexan-3-yl] dihydrogen phosphate |
| SMILES | CC(=S)[C@H](OP(=O)(O)O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H13O7PS/c1-3(15)6(13-14(10,11)12)5(9)4(8)2-7/h4-9H,2H2,1H3,(H2,10,11,12)/t4-,5-,6+/m1/s1 |
| InChIKey | ZOWOKBAAXVGGRR-PBXRRBTRSA-N |
| XLogP | -1.43 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.20 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|