C6H12O4S — CID 140693251
(3S,4R,5R)-3,4,5,6-tetrahydroxyhexane-2-thione (PubChem CID 140693251) has the molecular formula C6H12O4S and a molecular weight of 180.22 g/mol. Its IUPAC name is (3S,4R,5R)-3,4,5,6-tetrahydroxyhexane-2-thione.
| Compound Name | (3S,4R,5R)-3,4,5,6-tetrahydroxyhexane-2-thione |
|---|---|
| PubChem CID | 140693251 |
| Molecular Formula | C6H12O4S |
| Molecular Weight | 180.22 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | (3S,4R,5R)-3,4,5,6-tetrahydroxyhexane-2-thione |
| SMILES | CC(=S)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H12O4S/c1-3(11)5(9)6(10)4(8)2-7/h4-10H,2H2,1H3/t4-,5-,6-/m1/s1 |
| InChIKey | SOCGDJNMSUGUTO-HSUXUTPPSA-N |
| XLogP | -1.55 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.22 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|