C22H42O20 — CID 89096209
ethenyl 2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18-heptadecahydroxynonadecyl carbonate (PubChem CID 89096209) has the molecular formula C22H42O20 and a molecular weight of 626.56 g/mol. Its IUPAC name is ethenyl 2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18-heptadecahydroxynonadecyl carbonate.
| Compound Name | ethenyl 2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18-heptadecahydroxynonadecyl carbonate |
|---|---|
| PubChem CID | 89096209 |
| Molecular Formula | C22H42O20 |
| Molecular Weight | 626.56 g/mol |
| Exact Mass | 626.23 |
| IUPAC Name | ethenyl 2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18-heptadecahydroxynonadecyl carbonate |
| SMILES | C=COC(=O)OCC(O)C(O)C(O)C(O)C(O)C(O)C(O)C(O)C(O)C(O)C(O)C(O)C(O)C(O)C(O)C(O)C(C)O |
| InChI | InChI=1S/C22H42O20/c1-3-41-22(40)42-4-6(24)8(26)10(28)12(30)14(32)16(34)18(36)20(38)21(39)19(37)17(35)15(33)13(31)11(29)9(27)7(25)5(2)23/h3,5-21,23-39H,1,4H2,2H3 |
| InChIKey | ZDSVKHIGDNMLES-UHFFFAOYSA-N |
| XLogP | -9.56 |
| TPSA | 379.44 Ų |
| H-Bond Donors | 17 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.56 |
| LogP ≤ 5 | -9.56 |
| H-Bond Donors ≤ 5 | 17 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|