C8H17NO6 — CID 54132443
(2S,3R,5R)-1-amino-2,3,5,6,7-pentahydroxyoctan-4-one (PubChem CID 54132443) has the molecular formula C8H17NO6 and a molecular weight of 223.23 g/mol. Its IUPAC name is (2S,3R,5R)-1-amino-2,3,5,6,7-pentahydroxyoctan-4-one.
| Compound Name | (2S,3R,5R)-1-amino-2,3,5,6,7-pentahydroxyoctan-4-one |
|---|---|
| PubChem CID | 54132443 |
| Molecular Formula | C8H17NO6 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | (2S,3R,5R)-1-amino-2,3,5,6,7-pentahydroxyoctan-4-one |
| SMILES | CC(O)C(O)[C@@H](O)C(=O)[C@H](O)[C@@H](O)CN |
| InChI | InChI=1S/C8H17NO6/c1-3(10)5(12)7(14)8(15)6(13)4(11)2-9/h3-7,10-14H,2,9H2,1H3/t3?,4-,5?,6+,7+/m0/s1 |
| InChIKey | NVHLVQHDQCUCJN-HNPNYMNYSA-N |
| XLogP | -3.66 |
| TPSA | 144.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | -3.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |