C8H18N2O6 — CID 91559405
(5S,6R,7R)-1,2-diamino-3,5,6,7,8-pentahydroxyoctan-4-one (PubChem CID 91559405) has the molecular formula C8H18N2O6 and a molecular weight of 238.24 g/mol. Its IUPAC name is (5S,6R,7R)-1,2-diamino-3,5,6,7,8-pentahydroxyoctan-4-one.
| Compound Name | (5S,6R,7R)-1,2-diamino-3,5,6,7,8-pentahydroxyoctan-4-one |
|---|---|
| PubChem CID | 91559405 |
| Molecular Formula | C8H18N2O6 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (5S,6R,7R)-1,2-diamino-3,5,6,7,8-pentahydroxyoctan-4-one |
| SMILES | NCC(N)C(O)C(=O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C8H18N2O6/c9-1-3(10)5(13)7(15)8(16)6(14)4(12)2-11/h3-6,8,11-14,16H,1-2,9-10H2/t3?,4-,5?,6-,8+/m1/s1 |
| InChIKey | ADCWTRKXPFBJRQ-PVNKXZQBSA-N |
| XLogP | -4.72 |
| TPSA | 170.26 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | -4.72 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |