C6H13NO5 — CID 141169470
(3S,4R,5R)-1-amino-1-deuterio-3,4,5,6-tetrahydroxyhexan-2-one (PubChem CID 141169470) has the molecular formula C6H13NO5 and a molecular weight of 180.18 g/mol. Its IUPAC name is (3S,4R,5R)-1-amino-1-deuterio-3,4,5,6-tetrahydroxyhexan-2-one.
| Compound Name | (3S,4R,5R)-1-amino-1-deuterio-3,4,5,6-tetrahydroxyhexan-2-one |
|---|---|
| PubChem CID | 141169470 |
| Molecular Formula | C6H13NO5 |
| Molecular Weight | 180.18 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | (3S,4R,5R)-1-amino-1-deuterio-3,4,5,6-tetrahydroxyhexan-2-one |
| SMILES | [2H]C(N)C(=O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H13NO5/c7-1-3(9)5(11)6(12)4(10)2-8/h4-6,8,10-12H,1-2,7H2/t4-,5-,6-/m1/s1/i1D/t1?,4-,5-,6- |
| InChIKey | XBBIACPUMILHFE-HUAIMCFWSA-N |
| XLogP | -3.41 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.18 |
| LogP ≤ 5 | -3.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |