C5H11IO2 — CID 134993027
(3R,4R)-4-iodopentane-2,3-diol (PubChem CID 134993027) has the molecular formula C5H11IO2 and a molecular weight of 230.05 g/mol. Its IUPAC name is (3R,4R)-4-iodopentane-2,3-diol.
| Compound Name | (3R,4R)-4-iodopentane-2,3-diol |
|---|---|
| PubChem CID | 134993027 |
| Molecular Formula | C5H11IO2 |
| Molecular Weight | 230.05 g/mol |
| Exact Mass | 229.98 |
| IUPAC Name | (3R,4R)-4-iodopentane-2,3-diol |
| SMILES | CC(O)[C@@H](O)[C@@H](C)I |
| InChI | InChI=1S/C5H11IO2/c1-3(6)5(8)4(2)7/h3-5,7-8H,1-2H3/t3-,4?,5+/m1/s1 |
| InChIKey | FKCUVPIQZVWTTE-DEOSMSJNSA-N |
| XLogP | 0.55 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.05 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|