About (3R)-1,3-diiodobutane
(3R)-1,3-diiodobutane (PubChem CID 76764224) has the molecular formula C4H8I2
and a molecular weight of 309.92 g/mol. Its IUPAC name is (3R)-1,3-diiodobutane.
Molecular Properties
| Compound Name | (3R)-1,3-diiodobutane |
| PubChem CID | 76764224 |
| Molecular Formula | C4H8I2 |
| Molecular Weight | 309.92 g/mol |
| Exact Mass | 309.87 |
| IUPAC Name | (3R)-1,3-diiodobutane |
| SMILES | C[C@@H](I)CCI |
| InChI | InChI=1S/C4H8I2/c1-4(6)2-3-5/h4H,2-3H2,1H3/t4-/m1/s1 |
| InChIKey | ZFMSVHPAOMPMMF-SCSAIBSYSA-N |
| XLogP | 2.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.92 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (3R)-1,3-diiodobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1,3-diiodobutane?
The IUPAC name of (3R)-1,3-diiodobutane (CID 76764224) is (3R)-1,3-diiodobutane.
What is the SMILES notation for (3R)-1,3-diiodobutane?
The canonical SMILES for (3R)-1,3-diiodobutane is C[C@@H](I)CCI.
What is the InChIKey of (3R)-1,3-diiodobutane?
The InChIKey is ZFMSVHPAOMPMMF-SCSAIBSYSA-N. The full InChI is InChI=1S/C4H8I2/c1-4(6)2-3-5/h4H,2-3H2,1H3/t4-/m1/s1.
What are the key properties of (3R)-1,3-diiodobutane?
(3R)-1,3-diiodobutane has a molecular weight of 309.92 g/mol, XLogP of 2.63, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1,3-diiodobutane is sourced from PubChem (CID 76764224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).