C9H18I2O — CID 18921089
1,7-diiodo-3,5-dimethylheptan-4-ol (PubChem CID 18921089) has the molecular formula C9H18I2O and a molecular weight of 396.05 g/mol. Its IUPAC name is 1,7-diiodo-3,5-dimethylheptan-4-ol.
| Compound Name | 1,7-diiodo-3,5-dimethylheptan-4-ol |
|---|---|
| PubChem CID | 18921089 |
| Molecular Formula | C9H18I2O |
| Molecular Weight | 396.05 g/mol |
| Exact Mass | 395.94 |
| IUPAC Name | 1,7-diiodo-3,5-dimethylheptan-4-ol |
| SMILES | CC(CCI)C(O)C(C)CCI |
| InChI | InChI=1S/C9H18I2O/c1-7(3-5-10)9(12)8(2)4-6-11/h7-9,12H,3-6H2,1-2H3 |
| InChIKey | NGWVLDMSTQPGRM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.05 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|